About N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide
N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide (PubChem CID 123353034) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide.
Molecular Properties
| Compound Name | N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide |
| PubChem CID | 123353034 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide |
| SMILES | CC=C(CC=C(CC)/N=C/N)OC |
| InChI | InChI=1S/C10H18N2O/c1-4-9(12-8-11)6-7-10(5-2)13-3/h5-6,8H,4,7H2,1-3H3,(H2,11,12) |
| InChIKey | XTYRGBJPUWIJDA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide?
The IUPAC name of N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide (CID 123353034) is N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide.
What is the SMILES notation for N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide?
The canonical SMILES for N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide is CC=C(CC=C(CC)/N=C/N)OC.
What is the InChIKey of N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide?
The InChIKey is XTYRGBJPUWIJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-4-9(12-8-11)6-7-10(5-2)13-3/h5-6,8H,4,7H2,1-3H3,(H2,11,12).
What are the key properties of N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide?
N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide has a molecular weight of 182.27 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-methoxyocta-3,6-dien-3-yl)methanimidamide is sourced from PubChem (CID 123353034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).