C16H29BN2O4 — CID 123353614
2,2-dimethylpropyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate (PubChem CID 123353614) has the molecular formula C16H29BN2O4 and a molecular weight of 324.23 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate.
| Compound Name | 2,2-dimethylpropyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 123353614 |
| Molecular Formula | C16H29BN2O4 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2,2-dimethylpropyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
| SMILES | CN1NC(C(=O)OCC(C)(C)C)C=C1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H29BN2O4/c1-14(2,3)10-21-13(20)11-9-12(19(8)18-11)17-22-15(4,5)16(6,7)23-17/h9,11,18H,10H2,1-8H3 |
| InChIKey | PXFXJDWUMZZPDF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|