C21H40 — CID 123353915
1-(4,5-dimethyl-3-prop-1-en-2-yl-3-propylhexyl)-4-methylcyclohexane (PubChem CID 123353915) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is 1-(4,5-dimethyl-3-prop-1-en-2-yl-3-propylhexyl)-4-methylcyclohexane.
| Compound Name | 1-(4,5-dimethyl-3-prop-1-en-2-yl-3-propylhexyl)-4-methylcyclohexane |
|---|---|
| PubChem CID | 123353915 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | 1-(4,5-dimethyl-3-prop-1-en-2-yl-3-propylhexyl)-4-methylcyclohexane |
| SMILES | C=C(C)C(CCC)(CCC1CCC(C)CC1)C(C)C(C)C |
| InChI | InChI=1S/C21H40/c1-8-14-21(17(4)5,19(7)16(2)3)15-13-20-11-9-18(6)10-12-20/h16,18-20H,4,8-15H2,1-3,5-7H3 |
| InChIKey | MFCAGFDMNILBRW-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|