C20H32O3 — CID 123354672
3-(2-ethylbutyl)-9-hydroxy-6,9-dimethyl-3,3a,4,5,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one (PubChem CID 123354672) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 3-(2-ethylbutyl)-9-hydroxy-6,9-dimethyl-3,3a,4,5,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one.
| Compound Name | 3-(2-ethylbutyl)-9-hydroxy-6,9-dimethyl-3,3a,4,5,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 123354672 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 3-(2-ethylbutyl)-9-hydroxy-6,9-dimethyl-3,3a,4,5,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| SMILES | CCC(CC)CC1C(=O)OC2C1CCC(C)=C1CCC(C)(O)C12 |
| InChI | InChI=1S/C20H32O3/c1-5-13(6-2)11-16-15-8-7-12(3)14-9-10-20(4,22)17(14)18(15)23-19(16)21/h13,15-18,22H,5-11H2,1-4H3 |
| InChIKey | DOOIKDQMXJQUIX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|