C28H52N12 — CID 123355370
2,5,11,14,20,23,29,35,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 123355370) has the molecular formula C28H52N12 and a molecular weight of 556.81 g/mol. Its IUPAC name is 2,5,11,14,20,23,29,35,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 2,5,11,14,20,23,29,35,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 123355370 |
| Molecular Formula | C28H52N12 |
| Molecular Weight | 556.81 g/mol |
| Exact Mass | 556.44 |
| IUPAC Name | 2,5,11,14,20,23,29,35,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | C1CNC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCNC63)C3CCCNC53)C3NCCCC43)C2C1 |
| InChI | InChI=1S/C28H52N12/c1-5-13-17(29-9-1)25-34-21(13)33-22-14-6-2-11-31-19(14)27(35-22)40-28-20-16(8-4-12-32-20)24(39-28)38-26-18-15(7-3-10-30-18)23(36-25)37-26/h13-40H,1-12H2 |
| InChIKey | DOGWGDPXOOFUEE-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 144.36 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.81 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |