C15H24ClN5O — CID 123355577
amino-[2-chloro-4-[(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-5-yl]methanol (PubChem CID 123355577) has the molecular formula C15H24ClN5O and a molecular weight of 325.84 g/mol. Its IUPAC name is amino-[2-chloro-4-[(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-5-yl]methanol.
| Compound Name | amino-[2-chloro-4-[(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 123355577 |
| Molecular Formula | C15H24ClN5O |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | amino-[2-chloro-4-[(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-5-yl]methanol |
| SMILES | CC1(C)CC(Nc2nc(Cl)ncc2C(N)O)CC2CCCN21 |
| InChI | InChI=1S/C15H24ClN5O/c1-15(2)7-9(6-10-4-3-5-21(10)15)19-13-11(12(17)22)8-18-14(16)20-13/h8-10,12,22H,3-7,17H2,1-2H3,(H,18,19,20) |
| InChIKey | VSUIFEQXXPTTOU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|