C14H9N2O8+ — CID 123355894
4,5-dihydroxy-6H-pyrrolo[2,3-f]quinolin-1-ium-2,7,9-tricarboxylic acid (PubChem CID 123355894) has the molecular formula C14H9N2O8+ and a molecular weight of 333.23 g/mol. Its IUPAC name is 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinolin-1-ium-2,7,9-tricarboxylic acid.
| Compound Name | 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinolin-1-ium-2,7,9-tricarboxylic acid |
|---|---|
| PubChem CID | 123355894 |
| Molecular Formula | C14H9N2O8+ |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinolin-1-ium-2,7,9-tricarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c2c([nH]1)c(O)c(O)c1cc(C(=O)O)[nH+]c12 |
| InChI | InChI=1S/C14H8N2O8/c17-10-4-2-6(14(23)24)15-8(4)7-3(12(19)20)1-5(13(21)22)16-9(7)11(10)18/h1-2,16-18H,(H,19,20)(H,21,22)(H,23,24)/p+1 |
| InChIKey | QKZCLDGSTDNTDJ-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 182.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|