About 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium
3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium (PubChem CID 123356120) has the molecular formula C6H9ClNO+
and a molecular weight of 146.60 g/mol. Its IUPAC name is 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium.
Molecular Properties
| Compound Name | 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium |
| PubChem CID | 123356120 |
| Molecular Formula | C6H9ClNO+ |
| Molecular Weight | 146.60 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium |
| SMILES | C=C(Cl)C(=C)[N+](=O)CC |
| InChI | InChI=1S/C6H9ClNO/c1-4-8(9)6(3)5(2)7/h2-4H2,1H3/q+1 |
| InChIKey | MYQXTLGETHVLNJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.60 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium?
The IUPAC name of 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium (CID 123356120) is 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium.
What is the SMILES notation for 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium?
The canonical SMILES for 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium is C=C(Cl)C(=C)[N+](=O)CC.
What is the InChIKey of 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium?
The InChIKey is MYQXTLGETHVLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClNO/c1-4-8(9)6(3)5(2)7/h2-4H2,1H3/q+1.
What are the key properties of 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium?
3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium has a molecular weight of 146.60 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobuta-1,3-dien-2-yl-ethyl-oxoazanium is sourced from PubChem (CID 123356120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).