C20H24ClN7O — CID 123356127
N-[N'-tert-butyl-N-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]carbamimidoyl]-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 123356127) has the molecular formula C20H24ClN7O and a molecular weight of 413.91 g/mol. Its IUPAC name is N-[N'-tert-butyl-N-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]carbamimidoyl]-2,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[N'-tert-butyl-N-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]carbamimidoyl]-2,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 123356127 |
| Molecular Formula | C20H24ClN7O |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[N'-tert-butyl-N-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]carbamimidoyl]-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/C(=N\C(C)(C)C)Nc2cc(-c3ccc(Cl)cc3)[nH]n2)n(C)n1 |
| InChI | InChI=1S/C20H24ClN7O/c1-12-10-16(28(5)27-12)18(29)23-19(24-20(2,3)4)22-17-11-15(25-26-17)13-6-8-14(21)9-7-13/h6-11H,1-5H3,(H3,22,23,24,25,26,29) |
| InChIKey | JQCCRQSZJSGWFI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|