C27H39ClO2 — CID 123356241
trans-(1R,3S)-5-[2-[(1R,7aR)-1-[(2R,5R)-5-chloro-5-cyclopropylpent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 123356241) has the molecular formula C27H39ClO2 and a molecular weight of 431.06 g/mol. Its IUPAC name is trans-(1R,3S)-5-[2-[(1R,7aR)-1-[(2R,5R)-5-chloro-5-cyclopropylpent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S)-5-[2-[(1R,7aR)-1-[(2R,5R)-5-chloro-5-cyclopropylpent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 123356241 |
| Molecular Formula | C27H39ClO2 |
| Molecular Weight | 431.06 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | trans-(1R,3S)-5-[2-[(1R,7aR)-1-[(2R,5R)-5-chloro-5-cyclopropylpent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)C=C[C@H](Cl)C2CC2)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H39ClO2/c1-17(6-13-25(28)20-8-9-20)23-11-12-24-19(5-4-14-27(23,24)3)7-10-21-15-22(29)16-26(30)18(21)2/h6-7,10,13,17,20,22-26,29-30H,2,4-5,8-9,11-12,14-16H2,1,3H3/t17-,22-,23-,24?,25+,26+,27-/m1/s1 |
| InChIKey | GAOFGMSUSAWFHX-NTTUUZONSA-N |
| XLogP | 6.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.06 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|