C16H25NO5 — CID 123356302
methyl (3R,7aR)-6-butyl-3-tert-butyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 123356302) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is methyl (3R,7aR)-6-butyl-3-tert-butyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (3R,7aR)-6-butyl-3-tert-butyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 123356302 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | methyl (3R,7aR)-6-butyl-3-tert-butyl-5,7-dioxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | CCCCC1C(=O)N2[C@@H](C(C)(C)C)OC[C@]2(C(=O)OC)C1=O |
| InChI | InChI=1S/C16H25NO5/c1-6-7-8-10-11(18)16(14(20)21-5)9-22-13(15(2,3)4)17(16)12(10)19/h10,13H,6-9H2,1-5H3/t10?,13-,16-/m1/s1 |
| InChIKey | YYKGTPIXZCJKQI-NKRLSEITSA-N |
| XLogP | 1.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|