C20H31N — CID 123356375
(13,17-dimethyl-2,3,4,7,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-8-yl)methanimine (PubChem CID 123356375) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is (13,17-dimethyl-2,3,4,7,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-8-yl)methanimine.
| Compound Name | (13,17-dimethyl-2,3,4,7,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-8-yl)methanimine |
|---|---|
| PubChem CID | 123356375 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | (13,17-dimethyl-2,3,4,7,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-8-yl)methanimine |
| SMILES | [H]/N=C/C12CC=C3CCCCC3C1CCC1(C)C(C)CCC12 |
| InChI | InChI=1S/C20H31N/c1-14-7-8-18-19(14,2)11-10-17-16-6-4-3-5-15(16)9-12-20(17,18)13-21/h9,13-14,16-18,21H,3-8,10-12H2,1-2H3/b21-13+ |
| InChIKey | AGCDNBQXWIQNOD-FYJGNVAPSA-N |
| XLogP | 5.61 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|