C23H35NO4 — CID 123356444
3-hydroxy-2-(2-methoxyethoxy)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 123356444) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-hydroxy-2-(2-methoxyethoxy)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | 3-hydroxy-2-(2-methoxyethoxy)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 123356444 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 3-hydroxy-2-(2-methoxyethoxy)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | COCCOC1CC2(C)C(CCC3C4CCC(C#N)C4(C)CC(=O)C32)CC1O |
| InChI | InChI=1S/C23H35NO4/c1-22-11-19(26)21-16(17(22)7-5-15(22)13-24)6-4-14-10-18(25)20(12-23(14,21)2)28-9-8-27-3/h14-18,20-21,25H,4-12H2,1-3H3 |
| InChIKey | VATXZYZAGIPMQO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|