C26H24N6OS — CID 123356602
2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide (PubChem CID 123356602) has the molecular formula C26H24N6OS and a molecular weight of 468.59 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide.
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 123356602 |
| Molecular Formula | C26H24N6OS |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide |
| SMILES | Cc1nc(C)c(-c2nc3ccc(C(=O)NCCCn4ccnc4)cc3nc2-c2ccccc2)s1 |
| InChI | InChI=1S/C26H24N6OS/c1-17-25(34-18(2)29-17)24-23(19-7-4-3-5-8-19)31-22-15-20(9-10-21(22)30-24)26(33)28-11-6-13-32-14-12-27-16-32/h3-5,7-10,12,14-16H,6,11,13H2,1-2H3,(H,28,33) |
| InChIKey | OAELRXOVQMRBQM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|