C20H31F4N5O3 — CID 123356798
2-[2-(4,4-difluorocyclohexyl)-2-[2-(methylamino)propanoylamino]acetyl]-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-3-carboxamide (PubChem CID 123356798) has the molecular formula C20H31F4N5O3 and a molecular weight of 465.49 g/mol. Its IUPAC name is 2-[2-(4,4-difluorocyclohexyl)-2-[2-(methylamino)propanoylamino]acetyl]-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | 2-[2-(4,4-difluorocyclohexyl)-2-[2-(methylamino)propanoylamino]acetyl]-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 123356798 |
| Molecular Formula | C20H31F4N5O3 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[2-(4,4-difluorocyclohexyl)-2-[2-(methylamino)propanoylamino]acetyl]-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazine-3-carboxamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CC2CC(F)(F)CN2CC1C(N)=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C20H31F4N5O3/c1-11(26-2)17(31)27-15(12-3-5-19(21,22)6-4-12)18(32)29-8-13-7-20(23,24)10-28(13)9-14(29)16(25)30/h11-15,26H,3-10H2,1-2H3,(H2,25,30)(H,27,31) |
| InChIKey | XMUKQLFMRQWIGM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |