C11H8F8O — CID 123356933
1,3-difluoro-2-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]benzene (PubChem CID 123356933) has the molecular formula C11H8F8O and a molecular weight of 308.17 g/mol. Its IUPAC name is 1,3-difluoro-2-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]benzene.
| Compound Name | 1,3-difluoro-2-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]benzene |
|---|---|
| PubChem CID | 123356933 |
| Molecular Formula | C11H8F8O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1,3-difluoro-2-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]benzene |
| SMILES | CC(OCc1c(F)cccc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F8O/c1-9(10(14,15)16,11(17,18)19)20-5-6-7(12)3-2-4-8(6)13/h2-4H,5H2,1H3 |
| InChIKey | UCIHDQRMEMNDHU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |