C21H31N3O2 — CID 123357258
N-(2-methoxyethyl)-3,9-dimethyl-2-(pyrrolidin-3-ylmethyl)-3,4-dihydro-2-benzazepine-8-carboxamide (PubChem CID 123357258) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3,9-dimethyl-2-(pyrrolidin-3-ylmethyl)-3,4-dihydro-2-benzazepine-8-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3,9-dimethyl-2-(pyrrolidin-3-ylmethyl)-3,4-dihydro-2-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 123357258 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-(2-methoxyethyl)-3,9-dimethyl-2-(pyrrolidin-3-ylmethyl)-3,4-dihydro-2-benzazepine-8-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(c1C)=CN(CC1CCNC1)C(C)CC=2 |
| InChI | InChI=1S/C21H31N3O2/c1-15-4-5-18-6-7-19(21(25)23-10-11-26-3)16(2)20(18)14-24(15)13-17-8-9-22-12-17/h5-7,14-15,17,22H,4,8-13H2,1-3H3,(H,23,25) |
| InChIKey | ICZSGNNMWBNDPM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|