C15H25N2O3+ — CID 123357354
[2-[2,2-dimethylpropyl(methyl)amino]-6-methoxycyclohepta-1,3,6-trien-1-yl]-methoxy-oxoazanium (PubChem CID 123357354) has the molecular formula C15H25N2O3+ and a molecular weight of 281.38 g/mol. Its IUPAC name is [2-[2,2-dimethylpropyl(methyl)amino]-6-methoxycyclohepta-1,3,6-trien-1-yl]-methoxy-oxoazanium.
| Compound Name | [2-[2,2-dimethylpropyl(methyl)amino]-6-methoxycyclohepta-1,3,6-trien-1-yl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 123357354 |
| Molecular Formula | C15H25N2O3+ |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | [2-[2,2-dimethylpropyl(methyl)amino]-6-methoxycyclohepta-1,3,6-trien-1-yl]-methoxy-oxoazanium |
| SMILES | COC1=CC([N+](=O)OC)=C(N(C)CC(C)(C)C)C=CC1 |
| InChI | InChI=1S/C15H25N2O3/c1-15(2,3)11-16(4)13-9-7-8-12(19-5)10-14(13)17(18)20-6/h7,9-10H,8,11H2,1-6H3/q+1 |
| InChIKey | VKNZLDBDIDDHBW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|