C14H15N2+ — CID 123357495
5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium (PubChem CID 123357495) has the molecular formula C14H15N2+ and a molecular weight of 211.29 g/mol. Its IUPAC name is 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium.
| Compound Name | 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium |
|---|---|
| PubChem CID | 123357495 |
| Molecular Formula | C14H15N2+ |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium |
| SMILES | C[N+]1=c2ccccc2=NC2CCC=CC=C21 |
| InChI | InChI=1S/C14H15N2/c1-16-13-9-4-2-3-7-11(13)15-12-8-5-6-10-14(12)16/h2,4-6,8-11H,3,7H2,1H3/q+1 |
| InChIKey | VWMBXFGIPRDEIV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|