About 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium
5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium (PubChem CID 123357495) has the molecular formula C14H15N2+
and a molecular weight of 211.29 g/mol. Its IUPAC name is 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium.
Molecular Properties
| Compound Name | 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium |
| PubChem CID | 123357495 |
| Molecular Formula | C14H15N2+ |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium |
| SMILES | C[N+]1=c2ccccc2=NC2CCC=CC=C21 |
| InChI | InChI=1S/C14H15N2/c1-16-13-9-4-2-3-7-11(13)15-12-8-5-6-10-14(12)16/h2,4-6,8-11H,3,7H2,1H3/q+1 |
| InChIKey | VWMBXFGIPRDEIV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium?
The IUPAC name of 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium (CID 123357495) is 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium.
What is the SMILES notation for 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium?
The canonical SMILES for 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium is C[N+]1=c2ccccc2=NC2CCC=CC=C21.
What is the InChIKey of 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium?
The InChIKey is VWMBXFGIPRDEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N2/c1-16-13-9-4-2-3-7-11(13)15-12-8-5-6-10-14(12)16/h2,4-6,8-11H,3,7H2,1H3/q+1.
What are the key properties of 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium?
5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium has a molecular weight of 211.29 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-10,10a-dihydro-9H-cyclohepta[b]quinoxalin-5-ium is sourced from PubChem (CID 123357495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).