About N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide
N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide (PubChem CID 123357613) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide.
Molecular Properties
| Compound Name | N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide |
| PubChem CID | 123357613 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide |
| SMILES | C=C/N=C/N=C/C(=C)CC(C)(C)C |
| InChI | InChI=1S/C11H18N2/c1-6-12-9-13-8-10(2)7-11(3,4)5/h6,8-9H,1-2,7H2,3-5H3/b12-9+,13-8+ |
| InChIKey | FBLFHWLEZSCTAY-GHEQENTPSA-N |
| XLogP | 3.22 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide?
The IUPAC name of N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide (CID 123357613) is N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide.
What is the SMILES notation for N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide?
The canonical SMILES for N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide is C=C/N=C/N=C/C(=C)CC(C)(C)C.
What is the InChIKey of N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide?
The InChIKey is FBLFHWLEZSCTAY-GHEQENTPSA-N. The full InChI is InChI=1S/C11H18N2/c1-6-12-9-13-8-10(2)7-11(3,4)5/h6,8-9H,1-2,7H2,3-5H3/b12-9+,13-8+.
What are the key properties of N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide?
N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide has a molecular weight of 178.28 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethyl-2-methylidenepentylidene)-N'-ethenylmethanimidamide is sourced from PubChem (CID 123357613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).