C19H12F5NO3 — CID 123357917
8-ethenyl-2-ethyl-4-(2,3,4,5,6-pentafluorobenzoyl)-1,4-benzoxazin-3-one (PubChem CID 123357917) has the molecular formula C19H12F5NO3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 8-ethenyl-2-ethyl-4-(2,3,4,5,6-pentafluorobenzoyl)-1,4-benzoxazin-3-one.
| Compound Name | 8-ethenyl-2-ethyl-4-(2,3,4,5,6-pentafluorobenzoyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 123357917 |
| Molecular Formula | C19H12F5NO3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 8-ethenyl-2-ethyl-4-(2,3,4,5,6-pentafluorobenzoyl)-1,4-benzoxazin-3-one |
| SMILES | C=Cc1cccc2c1OC(CC)C(=O)N2C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H12F5NO3/c1-3-8-6-5-7-9-17(8)28-10(4-2)18(26)25(9)19(27)11-12(20)14(22)16(24)15(23)13(11)21/h3,5-7,10H,1,4H2,2H3 |
| InChIKey | FCTLBMUWHVTNPB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|