C17H25N — CID 123358693
N,4,6-trimethyl-3-(2-methylhex-1-en-3-yl)cyclohepta-2,4,6-trien-1-imine (PubChem CID 123358693) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is N,4,6-trimethyl-3-(2-methylhex-1-en-3-yl)cyclohepta-2,4,6-trien-1-imine.
| Compound Name | N,4,6-trimethyl-3-(2-methylhex-1-en-3-yl)cyclohepta-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 123358693 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N,4,6-trimethyl-3-(2-methylhex-1-en-3-yl)cyclohepta-2,4,6-trien-1-imine |
| SMILES | C=C(C)C(CCC)c1c/c(=N/C)cc(C)cc1C |
| InChI | InChI=1S/C17H25N/c1-7-8-16(12(2)3)17-11-15(18-6)10-13(4)9-14(17)5/h9-11,16H,2,7-8H2,1,3-6H3/b18-15+ |
| InChIKey | XDSLYXIQZDAWHI-OBGWFSINSA-N |
| XLogP | 4.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|