5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid

C7H7IN2O3S — CID 12335937

IUPAC5-[(2-iodoacetyl)amino]-3-methyl-1,2-thiazole-4-carboxylic acid
SMILESCC1=NSC(=C1C(=O)O)NC(=O)CI
InChIInChI=1S/C7H7IN2O3S/c1-3-5(7(12)13)6(14-10-3)9-4(11)2-8/h2H2,1H3,(H,9,11)(H,12,13)
InChIKeyGBYYBZIFQYWYFR-UHFFFAOYSA-N
MW326.11 g/mol
LogP1.70
Rot. Bonds3

About 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid

5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 12335937) has the molecular formula C7H7IN2O3S and a molecular weight of 326.11 g/mol. Its IUPAC name is 5-[(2-iodoacetyl)amino]-3-methyl-1,2-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid
PubChem CID12335937
Molecular FormulaC7H7IN2O3S
Molecular Weight326.11 g/mol
Exact Mass325.92
IUPAC Name5-[(2-iodoacetyl)amino]-3-methyl-1,2-thiazole-4-carboxylic acid
SMILESCC1=NSC(=C1C(=O)O)NC(=O)CI
InChIInChI=1S/C7H7IN2O3S/c1-3-5(7(12)13)6(14-10-3)9-4(11)2-8/h2H2,1H3,(H,9,11)(H,12,13)
InChIKeyGBYYBZIFQYWYFR-UHFFFAOYSA-N
XLogP1.70
TPSA108.00 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity251

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.11
LogP ≤ 51.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid (CID 12335937) is 5-[(2-iodoacetyl)amino]-3-methyl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid is CC1=NSC(=C1C(=O)O)NC(=O)CI.
What is the InChIKey of 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid?
The InChIKey is GBYYBZIFQYWYFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IN2O3S/c1-3-5(7(12)13)6(14-10-3)9-4(11)2-8/h2H2,1H3,(H,9,11)(H,12,13).
What are the key properties of 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid?
5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid has a molecular weight of 326.11 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 12335937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).