About 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid
5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 12335937) has the molecular formula C7H7IN2O3S
and a molecular weight of 326.11 g/mol. Its IUPAC name is 5-[(2-iodoacetyl)amino]-3-methyl-1,2-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid |
| PubChem CID | 12335937 |
| Molecular Formula | C7H7IN2O3S |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 325.92 |
| IUPAC Name | 5-[(2-iodoacetyl)amino]-3-methyl-1,2-thiazole-4-carboxylic acid |
| SMILES | CC1=NSC(=C1C(=O)O)NC(=O)CI |
| InChI | InChI=1S/C7H7IN2O3S/c1-3-5(7(12)13)6(14-10-3)9-4(11)2-8/h2H2,1H3,(H,9,11)(H,12,13) |
| InChIKey | GBYYBZIFQYWYFR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 251 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid (CID 12335937) is 5-[(2-iodoacetyl)amino]-3-methyl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid is CC1=NSC(=C1C(=O)O)NC(=O)CI.
What is the InChIKey of 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid?
The InChIKey is GBYYBZIFQYWYFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IN2O3S/c1-3-5(7(12)13)6(14-10-3)9-4(11)2-8/h2H2,1H3,(H,9,11)(H,12,13).
What are the key properties of 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid?
5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid has a molecular weight of 326.11 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-Iodoacetamido)-3-methyl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 12335937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).