About 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene
7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene (PubChem CID 123359462) has the molecular formula C9H11FO
and a molecular weight of 154.18 g/mol. Its IUPAC name is 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene.
Analyze 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene?
The IUPAC name of 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene (CID 123359462) is 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene.
What is the SMILES notation for 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene?
The canonical SMILES for 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene is COC1=CC(C)(F)C=CC=C1.
What is the InChIKey of 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene?
The InChIKey is DNLYGOPAVHYJIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO/c1-9(10)6-4-3-5-8(7-9)11-2/h3-7H,1-2H3.
What are the key properties of 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene?
7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene has a molecular weight of 154.18 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-methoxy-7-methylcyclohepta-1,3,5-triene is sourced from PubChem (CID 123359462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).