C17H20N2O3 — CID 123359534
1-ethyl-5-(4-propylideneocta-2,5,7-trienylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 123359534) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-ethyl-5-(4-propylideneocta-2,5,7-trienylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-ethyl-5-(4-propylideneocta-2,5,7-trienylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 123359534 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-ethyl-5-(4-propylideneocta-2,5,7-trienylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CC=CC(C=CC=C1C(=O)NC(=O)N(CC)C1=O)=CCC |
| InChI | InChI=1S/C17H20N2O3/c1-4-7-10-13(9-5-2)11-8-12-14-15(20)18-17(22)19(6-3)16(14)21/h4,7-12H,1,5-6H2,2-3H3,(H,18,20,22) |
| InChIKey | GVZUTORLKMEAMR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|