C21H26N10O3 — CID 123359759
2-(azepan-1-yl)-4-[4-[2-(2,2-dihydroxyethyl)tetrazol-5-yl]anilino]-6-methanimidoylpyrimidine-5-carboxamide (PubChem CID 123359759) has the molecular formula C21H26N10O3 and a molecular weight of 466.51 g/mol. Its IUPAC name is 2-(azepan-1-yl)-4-[4-[2-(2,2-dihydroxyethyl)tetrazol-5-yl]anilino]-6-methanimidoylpyrimidine-5-carboxamide.
| Compound Name | 2-(azepan-1-yl)-4-[4-[2-(2,2-dihydroxyethyl)tetrazol-5-yl]anilino]-6-methanimidoylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123359759 |
| Molecular Formula | C21H26N10O3 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 2-(azepan-1-yl)-4-[4-[2-(2,2-dihydroxyethyl)tetrazol-5-yl]anilino]-6-methanimidoylpyrimidine-5-carboxamide |
| SMILES | [H]/N=C/c1nc(N2CCCCCC2)nc(Nc2ccc(-c3nnn(CC(O)O)n3)cc2)c1C(N)=O |
| InChI | InChI=1S/C21H26N10O3/c22-11-15-17(18(23)34)20(26-21(25-15)30-9-3-1-2-4-10-30)24-14-7-5-13(6-8-14)19-27-29-31(28-19)12-16(32)33/h5-8,11,16,22,32-33H,1-4,9-10,12H2,(H2,23,34)(H,24,25,26)/b22-11+ |
| InChIKey | LYSLJCLHQQEZBJ-SSDVNMTOSA-N |
| XLogP | 0.66 |
| TPSA | 192.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|