C27H41BN4O5 — CID 123359893
methyl N-[(2S)-1-[(2S)-2-[4,4-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinazolin-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 123359893) has the molecular formula C27H41BN4O5 and a molecular weight of 512.46 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(2S)-2-[4,4-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinazolin-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(2S)-2-[4,4-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinazolin-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123359893 |
| Molecular Formula | C27H41BN4O5 |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | methyl N-[(2S)-1-[(2S)-2-[4,4-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinazolin-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C1=NC(C)(C)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2N1)C(C)C |
| InChI | InChI=1S/C27H41BN4O5/c1-16(2)21(30-24(34)35-9)23(33)32-14-10-11-20(32)22-29-19-15-17(12-13-18(19)25(3,4)31-22)28-36-26(5,6)27(7,8)37-28/h12-13,15-16,20-21H,10-11,14H2,1-9H3,(H,29,31)(H,30,34)/t20-,21-/m0/s1 |
| InChIKey | GKHHTVSZFQKTNQ-SFTDATJTSA-N |
| XLogP | 3.42 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|