C26H27F2N5O3S — CID 123359921
N-[1-[[(2R)-1-(2-cyano-5-hydroxy-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methyl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide (PubChem CID 123359921) has the molecular formula C26H27F2N5O3S and a molecular weight of 527.60 g/mol. Its IUPAC name is N-[1-[[(2R)-1-(2-cyano-5-hydroxy-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methyl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide.
| Compound Name | N-[1-[[(2R)-1-(2-cyano-5-hydroxy-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methyl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 123359921 |
| Molecular Formula | C26H27F2N5O3S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | N-[1-[[(2R)-1-(2-cyano-5-hydroxy-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methyl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CCC[C@@H]1Cn1c(NC(=O)c2ccc(C(F)F)s2)nc2ccccc21)CO |
| InChI | InChI=1S/C26H27F2N5O3S/c1-26(2,15-34)12-16(13-29)24(36)32-11-5-6-17(32)14-33-19-8-4-3-7-18(19)30-25(33)31-23(35)21-10-9-20(37-21)22(27)28/h3-4,7-10,12,17,22,34H,5-6,11,14-15H2,1-2H3,(H,30,31,35)/t17-/m1/s1 |
| InChIKey | MQEUGLCVJJZQIL-QGZVFWFLSA-N |
| XLogP | 4.75 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|