C9H10NP — CID 123360660
6-methyl-8,8a-dihydrophosphinino[2,3-b]pyridine (PubChem CID 123360660) has the molecular formula C9H10NP and a molecular weight of 163.16 g/mol. Its IUPAC name is 6-methyl-8,8a-dihydrophosphinino[2,3-b]pyridine.
| Compound Name | 6-methyl-8,8a-dihydrophosphinino[2,3-b]pyridine |
|---|---|
| PubChem CID | 123360660 |
| Molecular Formula | C9H10NP |
| Molecular Weight | 163.16 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 6-methyl-8,8a-dihydrophosphinino[2,3-b]pyridine |
| SMILES | CC1=CPC2N=CC=CC2=C1 |
| InChI | InChI=1S/C9H10NP/c1-7-5-8-3-2-4-10-9(8)11-6-7/h2-6,9,11H,1H3 |
| InChIKey | AARUUPNILAHCDB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|