C18H42O4Si4 — CID 123360679
2-(2-tert-butyl-4,4-dimethylpent-1-enyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 123360679) has the molecular formula C18H42O4Si4 and a molecular weight of 434.87 g/mol. Its IUPAC name is 2-(2-tert-butyl-4,4-dimethylpent-1-enyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-(2-tert-butyl-4,4-dimethylpent-1-enyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 123360679 |
| Molecular Formula | C18H42O4Si4 |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-(2-tert-butyl-4,4-dimethylpent-1-enyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CC(C)(C)CC(=C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1)C(C)(C)C |
| InChI | InChI=1S/C18H42O4Si4/c1-17(2,3)14-16(18(4,5)6)15-26(13)21-24(9,10)19-23(7,8)20-25(11,12)22-26/h15H,14H2,1-13H3 |
| InChIKey | NKJMEQFKGZEYQK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|