C28H23F5N4+2 — CID 123361042
2-ethyl-8,10-difluoro-5-methyl-4-[5-(1-methylpyridin-1-ium-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(16),3,6(11),7,9,12,14-heptaene (PubChem CID 123361042) has the molecular formula C28H23F5N4+2 and a molecular weight of 510.51 g/mol. Its IUPAC name is 2-ethyl-8,10-difluoro-5-methyl-4-[5-(1-methylpyridin-1-ium-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(16),3,6(11),7,9,12,14-heptaene.
| Compound Name | 2-ethyl-8,10-difluoro-5-methyl-4-[5-(1-methylpyridin-1-ium-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(16),3,6(11),7,9,12,14-heptaene |
|---|---|
| PubChem CID | 123361042 |
| Molecular Formula | C28H23F5N4+2 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 2-ethyl-8,10-difluoro-5-methyl-4-[5-(1-methylpyridin-1-ium-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(16),3,6(11),7,9,12,14-heptaene |
| SMILES | CCC12C=C(n3nc(C(F)(F)F)cc3-c3cccc[n+]3C)C1(C)c1cc(F)cc(F)c1-c1cccc[n+]12 |
| InChI | InChI=1S/C28H23F5N4/c1-4-27-16-24(37-22(15-23(34-37)28(31,32)33)20-9-5-7-11-35(20)3)26(27,2)18-13-17(29)14-19(30)25(18)21-10-6-8-12-36(21)27/h5-16H,4H2,1-3H3/q+2 |
| InChIKey | XUHIQNNSISQQRL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|