About 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine
1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine (PubChem CID 123361404) has the molecular formula C16H28FN
and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine.
Molecular Properties
| Compound Name | 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine |
| PubChem CID | 123361404 |
| Molecular Formula | C16H28FN |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine |
| SMILES | CC(F)=CC=C(C)C(C)CCCN1CCCCC1 |
| InChI | InChI=1S/C16H28FN/c1-14(15(2)9-10-16(3)17)8-7-13-18-11-5-4-6-12-18/h9-10,14H,4-8,11-13H2,1-3H3 |
| InChIKey | SGIXCLVETWXQHK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine?
The IUPAC name of 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine (CID 123361404) is 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine.
What is the SMILES notation for 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine?
The canonical SMILES for 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine is CC(F)=CC=C(C)C(C)CCCN1CCCCC1.
What is the InChIKey of 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine?
The InChIKey is SGIXCLVETWXQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28FN/c1-14(15(2)9-10-16(3)17)8-7-13-18-11-5-4-6-12-18/h9-10,14H,4-8,11-13H2,1-3H3.
What are the key properties of 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine?
1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine has a molecular weight of 253.41 g/mol, XLogP of 4.71, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-fluoro-4,5-dimethylnona-5,7-dienyl)piperidine is sourced from PubChem (CID 123361404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).