About 5,5-dimethyl-2H-azocine
5,5-dimethyl-2H-azocine (PubChem CID 123361504) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 5,5-dimethyl-2H-azocine.
Molecular Properties
| Compound Name | 5,5-dimethyl-2H-azocine |
| PubChem CID | 123361504 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 5,5-dimethyl-2H-azocine |
| SMILES | CC1(C)C=C/C=N\CC=C1 |
| InChI | InChI=1S/C9H13N/c1-9(2)5-3-7-10-8-4-6-9/h3-7H,8H2,1-2H3/b5-3?,6-4?,10-7- |
| InChIKey | IHDWZSNSALNVKX-YXVWUVGPSA-N |
| XLogP | 2.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-2H-azocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2H-azocine?
The IUPAC name of 5,5-dimethyl-2H-azocine (CID 123361504) is 5,5-dimethyl-2H-azocine.
What is the SMILES notation for 5,5-dimethyl-2H-azocine?
The canonical SMILES for 5,5-dimethyl-2H-azocine is CC1(C)C=C/C=N\CC=C1.
What is the InChIKey of 5,5-dimethyl-2H-azocine?
The InChIKey is IHDWZSNSALNVKX-YXVWUVGPSA-N. The full InChI is InChI=1S/C9H13N/c1-9(2)5-3-7-10-8-4-6-9/h3-7H,8H2,1-2H3/b5-3?,6-4?,10-7-.
What are the key properties of 5,5-dimethyl-2H-azocine?
5,5-dimethyl-2H-azocine has a molecular weight of 135.21 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2H-azocine is sourced from PubChem (CID 123361504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).