About 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane
3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane (PubChem CID 123361666) has the molecular formula C16H23N3
and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane |
| PubChem CID | 123361666 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane |
| SMILES | CC=CC(=CC)c1cnc(C2C3CCC(C3)N2C)[nH]1 |
| InChI | InChI=1S/C16H23N3/c1-4-6-11(5-2)14-10-17-16(18-14)15-12-7-8-13(9-12)19(15)3/h4-6,10,12-13,15H,7-9H2,1-3H3,(H,17,18) |
| InChIKey | VXIZMNQOEPEOSL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane?
The IUPAC name of 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane (CID 123361666) is 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane.
What is the SMILES notation for 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane?
The canonical SMILES for 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane is CC=CC(=CC)c1cnc(C2C3CCC(C3)N2C)[nH]1.
What is the InChIKey of 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane?
The InChIKey is VXIZMNQOEPEOSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3/c1-4-6-11(5-2)14-10-17-16(18-14)15-12-7-8-13(9-12)19(15)3/h4-6,10,12-13,15H,7-9H2,1-3H3,(H,17,18).
What are the key properties of 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane?
3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane has a molecular weight of 257.38 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-hexa-2,4-dien-3-yl-1H-imidazol-2-yl)-2-methyl-2-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 123361666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).