C17H25F3O3 — CID 123361710
(5R,6S,7S)-7-methoxy-3,5-dimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-trien-6-ol (PubChem CID 123361710) has the molecular formula C17H25F3O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is (5R,6S,7S)-7-methoxy-3,5-dimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-trien-6-ol.
| Compound Name | (5R,6S,7S)-7-methoxy-3,5-dimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-trien-6-ol |
|---|---|
| PubChem CID | 123361710 |
| Molecular Formula | C17H25F3O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (5R,6S,7S)-7-methoxy-3,5-dimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-trien-6-ol |
| SMILES | CO[C@H]1C=CCCC(C(F)(F)F)=CCOCC(C)=C[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H25F3O3/c1-12-10-13(2)16(21)15(22-3)7-5-4-6-14(17(18,19)20)8-9-23-11-12/h5,7-8,10,13,15-16,21H,4,6,9,11H2,1-3H3/t13-,15+,16+/m1/s1 |
| InChIKey | HOVCSKAFOWXLTR-KBMXLJTQSA-N |
| XLogP | 3.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|