About 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial
2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial (PubChem CID 123361974) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial.
Molecular Properties
| Compound Name | 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial |
| PubChem CID | 123361974 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial |
| SMILES | CCC=C(C)CC(C)(NCC(C=O)C=O)C(C)C |
| InChI | InChI=1S/C15H27NO2/c1-6-7-13(4)8-15(5,12(2)3)16-9-14(10-17)11-18/h7,10-12,14,16H,6,8-9H2,1-5H3 |
| InChIKey | WWCVTRAJIFEAQI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial?
The IUPAC name of 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial (CID 123361974) is 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial.
What is the SMILES notation for 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial?
The canonical SMILES for 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial is CCC=C(C)CC(C)(NCC(C=O)C=O)C(C)C.
What is the InChIKey of 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial?
The InChIKey is WWCVTRAJIFEAQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-6-7-13(4)8-15(5,12(2)3)16-9-14(10-17)11-18/h7,10-12,14,16H,6,8-9H2,1-5H3.
What are the key properties of 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial?
2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial has a molecular weight of 253.39 g/mol, XLogP of 2.75, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3,5-trimethyloct-5-en-3-ylamino)methyl]propanedial is sourced from PubChem (CID 123361974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).