C15H27N4+ — CID 123362370
N-[(2-ethylpyrimidin-4-yl)methyl]-N,1,1-trimethylpiperidin-1-ium-4-amine (PubChem CID 123362370) has the molecular formula C15H27N4+ and a molecular weight of 263.41 g/mol. Its IUPAC name is N-[(2-ethylpyrimidin-4-yl)methyl]-N,1,1-trimethylpiperidin-1-ium-4-amine.
| Compound Name | N-[(2-ethylpyrimidin-4-yl)methyl]-N,1,1-trimethylpiperidin-1-ium-4-amine |
|---|---|
| PubChem CID | 123362370 |
| Molecular Formula | C15H27N4+ |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N-[(2-ethylpyrimidin-4-yl)methyl]-N,1,1-trimethylpiperidin-1-ium-4-amine |
| SMILES | CCc1nccc(CN(C)C2CC[N+](C)(C)CC2)n1 |
| InChI | InChI=1S/C15H27N4/c1-5-15-16-9-6-13(17-15)12-18(2)14-7-10-19(3,4)11-8-14/h6,9,14H,5,7-8,10-12H2,1-4H3/q+1 |
| InChIKey | XJDYUSAUQCNMGS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|