C34H35Cl3N4O6 — CID 123362414
3-[3-[(2-methylpropan-2-yl)oxy]-4-[1-(3-oxopiperazine-1-carbonyl)-4-phenyl-5-(3,4,5-trichloro-1-methylcyclohexa-2,4-dien-1-yl)-4,5-dihydroimidazol-2-yl]phenyl]-3-oxopropanoic acid (PubChem CID 123362414) has the molecular formula C34H35Cl3N4O6 and a molecular weight of 702.04 g/mol. Its IUPAC name is 3-[3-[(2-methylpropan-2-yl)oxy]-4-[1-(3-oxopiperazine-1-carbonyl)-4-phenyl-5-(3,4,5-trichloro-1-methylcyclohexa-2,4-dien-1-yl)-4,5-dihydroimidazol-2-yl]phenyl]-3-oxopropanoic acid.
| Compound Name | 3-[3-[(2-methylpropan-2-yl)oxy]-4-[1-(3-oxopiperazine-1-carbonyl)-4-phenyl-5-(3,4,5-trichloro-1-methylcyclohexa-2,4-dien-1-yl)-4,5-dihydroimidazol-2-yl]phenyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 123362414 |
| Molecular Formula | C34H35Cl3N4O6 |
| Molecular Weight | 702.04 g/mol |
| Exact Mass | 700.16 |
| IUPAC Name | 3-[3-[(2-methylpropan-2-yl)oxy]-4-[1-(3-oxopiperazine-1-carbonyl)-4-phenyl-5-(3,4,5-trichloro-1-methylcyclohexa-2,4-dien-1-yl)-4,5-dihydroimidazol-2-yl]phenyl]-3-oxopropanoic acid |
| SMILES | CC(C)(C)Oc1cc(C(=O)CC(=O)O)ccc1C1=NC(c2ccccc2)C(C2(C)C=C(Cl)C(Cl)=C(Cl)C2)N1C(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C34H35Cl3N4O6/c1-33(2,3)47-25-14-20(24(42)15-27(44)45)10-11-21(25)31-39-29(19-8-6-5-7-9-19)30(34(4)16-22(35)28(37)23(36)17-34)41(31)32(46)40-13-12-38-26(43)18-40/h5-11,14,16,29-30H,12-13,15,17-18H2,1-4H3,(H,38,43)(H,44,45) |
| InChIKey | KPSHJUNKMAOFIW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.04 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|