C16H30F3N3O — CID 123362555
1-N-methyl-3-N-[[[(Z)-8,8,8-trifluorooct-5-en-4-ylidene]amino]methoxymethyl]pentane-1,3-diamine (PubChem CID 123362555) has the molecular formula C16H30F3N3O and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-N-methyl-3-N-[[[(Z)-8,8,8-trifluorooct-5-en-4-ylidene]amino]methoxymethyl]pentane-1,3-diamine.
| Compound Name | 1-N-methyl-3-N-[[[(Z)-8,8,8-trifluorooct-5-en-4-ylidene]amino]methoxymethyl]pentane-1,3-diamine |
|---|---|
| PubChem CID | 123362555 |
| Molecular Formula | C16H30F3N3O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-N-methyl-3-N-[[[(Z)-8,8,8-trifluorooct-5-en-4-ylidene]amino]methoxymethyl]pentane-1,3-diamine |
| SMILES | CCCC(/C=C\CC(F)(F)F)=NCOCNC(CC)CCNC |
| InChI | InChI=1S/C16H30F3N3O/c1-4-7-15(8-6-10-16(17,18)19)22-13-23-12-21-14(5-2)9-11-20-3/h6,8,14,20-21H,4-5,7,9-13H2,1-3H3/b8-6-,22-15? |
| InChIKey | RWBKBQIABDUIAO-YAKWKZBTSA-N |
| XLogP | 3.65 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|