C19H31BrOSi — CID 123362857
[[1-(3-bromophenyl)cyclopropyl]-dideuteriomethoxy]-tri(propan-2-yl)silane (PubChem CID 123362857) has the molecular formula C19H31BrOSi and a molecular weight of 385.46 g/mol. Its IUPAC name is [[1-(3-bromophenyl)cyclopropyl]-dideuteriomethoxy]-tri(propan-2-yl)silane.
| Compound Name | [[1-(3-bromophenyl)cyclopropyl]-dideuteriomethoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 123362857 |
| Molecular Formula | C19H31BrOSi |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [[1-(3-bromophenyl)cyclopropyl]-dideuteriomethoxy]-tri(propan-2-yl)silane |
| SMILES | [2H]C([2H])(O[Si](C(C)C)(C(C)C)C(C)C)C1(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C19H31BrOSi/c1-14(2)22(15(3)4,16(5)6)21-13-19(10-11-19)17-8-7-9-18(20)12-17/h7-9,12,14-16H,10-11,13H2,1-6H3/i13D2 |
| InChIKey | OPLVFRWXRYXDQP-KLTYLHELSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|