C35H45F6NO3S — CID 123363061
6-(3-fluorophenyl)-5-[6-[2-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 123363061) has the molecular formula C35H45F6NO3S and a molecular weight of 673.80 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-5-[6-[2-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(3-fluorophenyl)-5-[6-[2-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 123363061 |
| Molecular Formula | C35H45F6NO3S |
| Molecular Weight | 673.80 g/mol |
| Exact Mass | 673.30 |
| IUPAC Name | 6-(3-fluorophenyl)-5-[6-[2-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | O=S(=O)(CCCC1CCCN1CCCCCCC1=C(c2cccc(F)c2)CCCc2cc(O)ccc21)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H45F6NO3S/c36-28-12-5-10-26(24-28)31-16-6-11-27-25-30(43)17-18-32(27)33(31)15-3-1-2-4-20-42-21-7-13-29(42)14-8-22-46(44,45)23-9-19-34(37,38)35(39,40)41/h5,10,12,17-18,24-25,29,43H,1-4,6-9,11,13-16,19-23H2 |
| InChIKey | WMTQZBMKYOLNPC-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.80 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|