About 5-chloro-1,2-dimethyl-2H-pyridine
5-chloro-1,2-dimethyl-2H-pyridine (PubChem CID 123363175) has the molecular formula C7H10ClN
and a molecular weight of 143.62 g/mol. Its IUPAC name is 5-chloro-1,2-dimethyl-2H-pyridine.
Molecular Properties
| Compound Name | 5-chloro-1,2-dimethyl-2H-pyridine |
|---|
| PubChem CID | 123363175 |
|---|
| Molecular Formula | C7H10ClN |
|---|
| Molecular Weight | 143.62 g/mol |
|---|
| Exact Mass | 143.05 |
|---|
| IUPAC Name | 5-chloro-1,2-dimethyl-2H-pyridine |
|---|
| SMILES | CC1C=CC(Cl)=CN1C |
|---|
| InChI | InChI=1S/C7H10ClN/c1-6-3-4-7(8)5-9(6)2/h3-6H,1-2H3 |
|---|
| InChIKey | CPEUVESQUKXRJJ-UHFFFAOYSA-N |
|---|
| XLogP | 1.96 |
|---|
| TPSA | 3.24 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 1 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-1,2-dimethyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,2-dimethyl-2H-pyridine?
The IUPAC name of 5-chloro-1,2-dimethyl-2H-pyridine (CID 123363175) is 5-chloro-1,2-dimethyl-2H-pyridine.
What is the SMILES notation for 5-chloro-1,2-dimethyl-2H-pyridine?
The canonical SMILES for 5-chloro-1,2-dimethyl-2H-pyridine is CC1C=CC(Cl)=CN1C.
What is the InChIKey of 5-chloro-1,2-dimethyl-2H-pyridine?
The InChIKey is CPEUVESQUKXRJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN/c1-6-3-4-7(8)5-9(6)2/h3-6H,1-2H3.
What are the key properties of 5-chloro-1,2-dimethyl-2H-pyridine?
5-chloro-1,2-dimethyl-2H-pyridine has a molecular weight of 143.62 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,2-dimethyl-2H-pyridine is sourced from PubChem (CID 123363175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).