C8H15N5S — CID 1233632
2-(ethylamino)-6-(propan-2-ylamino)-1H-1,3,5-triazine-4-thione (PubChem CID 1233632) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-(ethylamino)-6-(propan-2-ylamino)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-(ethylamino)-6-(propan-2-ylamino)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 1233632 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(ethylamino)-6-(propan-2-ylamino)-1H-1,3,5-triazine-4-thione |
| SMILES | CCNc1nc(=S)nc(NC(C)C)[nH]1 |
| InChI | InChI=1S/C8H15N5S/c1-4-9-6-11-7(10-5(2)3)13-8(14)12-6/h5H,4H2,1-3H3,(H3,9,10,11,12,13,14) |
| InChIKey | BAAMDWUVIPLPOL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|