C19H20F4N2O — CID 123363860
N-[amino-(4-fluorophenyl)methylidene]-2-(1,1,1-trifluoropent-3-en-2-ylidene)hept-3-enamide (PubChem CID 123363860) has the molecular formula C19H20F4N2O and a molecular weight of 368.37 g/mol. Its IUPAC name is N-[amino-(4-fluorophenyl)methylidene]-2-(1,1,1-trifluoropent-3-en-2-ylidene)hept-3-enamide.
| Compound Name | N-[amino-(4-fluorophenyl)methylidene]-2-(1,1,1-trifluoropent-3-en-2-ylidene)hept-3-enamide |
|---|---|
| PubChem CID | 123363860 |
| Molecular Formula | C19H20F4N2O |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-[amino-(4-fluorophenyl)methylidene]-2-(1,1,1-trifluoropent-3-en-2-ylidene)hept-3-enamide |
| SMILES | CC=CC(=C(C=CCCC)C(=O)/N=C(\N)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H20F4N2O/c1-3-5-6-8-15(16(7-4-2)19(21,22)23)18(26)25-17(24)13-9-11-14(20)12-10-13/h4,6-12H,3,5H2,1-2H3,(H2,24,25,26) |
| InChIKey | LAFISWUVIGWQDV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|