C21H31ClN5O7P — CID 123364298
[[(Z)-4-(2-amino-6-chloropurin-9-yl)but-3-enyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 123364298) has the molecular formula C21H31ClN5O7P and a molecular weight of 531.93 g/mol. Its IUPAC name is [[(Z)-4-(2-amino-6-chloropurin-9-yl)but-3-enyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[(Z)-4-(2-amino-6-chloropurin-9-yl)but-3-enyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123364298 |
| Molecular Formula | C21H31ClN5O7P |
| Molecular Weight | 531.93 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | [[(Z)-4-(2-amino-6-chloropurin-9-yl)but-3-enyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(CC/C=C\n1cnc2c(Cl)nc(N)nc21)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H31ClN5O7P/c1-20(2,3)17(28)31-12-33-35(30,34-13-32-18(29)21(4,5)6)10-8-7-9-27-11-24-14-15(22)25-19(23)26-16(14)27/h7,9,11H,8,10,12-13H2,1-6H3,(H2,23,25,26)/b9-7- |
| InChIKey | ZZHLEMZCDICYCA-CLFYSBASSA-N |
| XLogP | 4.24 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|