C26H41NO7 — CID 123364395
1-amino-1-cyclohexa-1,5-dien-1-yl-5,5,7,7-tetramethyl-9-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]non-3-en-2-one (PubChem CID 123364395) has the molecular formula C26H41NO7 and a molecular weight of 479.61 g/mol. Its IUPAC name is 1-amino-1-cyclohexa-1,5-dien-1-yl-5,5,7,7-tetramethyl-9-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]non-3-en-2-one.
| Compound Name | 1-amino-1-cyclohexa-1,5-dien-1-yl-5,5,7,7-tetramethyl-9-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]non-3-en-2-one |
|---|---|
| PubChem CID | 123364395 |
| Molecular Formula | C26H41NO7 |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | 1-amino-1-cyclohexa-1,5-dien-1-yl-5,5,7,7-tetramethyl-9-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]non-3-en-2-one |
| SMILES | CC(C)(C=CC(=O)C(N)C1=CCCC=C1)CC(C)(C)CCOC1OC2(O)C(CO)C(O)C(O)C12 |
| InChI | InChI=1S/C26H41NO7/c1-24(2,11-10-18(29)20(27)16-8-6-5-7-9-16)15-25(3,4)12-13-33-23-19-22(31)21(30)17(14-28)26(19,32)34-23/h6,8-11,17,19-23,28,30-32H,5,7,12-15,27H2,1-4H3 |
| InChIKey | ORJVXCWHDVZPKU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|