C31H35F4N3O3 — CID 123364416
5-[6-(dimethylamino)-3-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-2-pyridinyl]-1-(7,7,7-trifluoro-4-methylhepta-1,3,5-trien-2-yl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 123364416) has the molecular formula C31H35F4N3O3 and a molecular weight of 573.63 g/mol. Its IUPAC name is 5-[6-(dimethylamino)-3-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-2-pyridinyl]-1-(7,7,7-trifluoro-4-methylhepta-1,3,5-trien-2-yl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | 5-[6-(dimethylamino)-3-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-2-pyridinyl]-1-(7,7,7-trifluoro-4-methylhepta-1,3,5-trien-2-yl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 123364416 |
| Molecular Formula | C31H35F4N3O3 |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | 5-[6-(dimethylamino)-3-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-2-pyridinyl]-1-(7,7,7-trifluoro-4-methylhepta-1,3,5-trien-2-yl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | C=C(C=C(C)C=CC(F)(F)F)C1OC(=O)N2C(c3nc(N(C)C)ccc3-c3cc(C(C)C)c(F)cc3OC)CCC12 |
| InChI | InChI=1S/C31H35F4N3O3/c1-17(2)21-15-22(26(40-7)16-23(21)32)20-8-11-27(37(5)6)36-28(20)24-9-10-25-29(41-30(39)38(24)25)19(4)14-18(3)12-13-31(33,34)35/h8,11-17,24-25,29H,4,9-10H2,1-3,5-7H3 |
| InChIKey | UTOULJMSMZVEMF-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|