About 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene
2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene (PubChem CID 123364554) has the molecular formula C20H20
and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene.
Molecular Properties
| Compound Name | 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene |
| PubChem CID | 123364554 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene |
| SMILES | C=CC(=CC1=Cc2ccccc2C1)CC1=CCCC=C1 |
| InChI | InChI=1S/C20H20/c1-2-16(12-17-8-4-3-5-9-17)13-18-14-19-10-6-7-11-20(19)15-18/h2,4,6-11,13-14H,1,3,5,12,15H2 |
| InChIKey | VWVDBHPRGLICOT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene?
The IUPAC name of 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene (CID 123364554) is 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene.
What is the SMILES notation for 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene?
The canonical SMILES for 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene is C=CC(=CC1=Cc2ccccc2C1)CC1=CCCC=C1.
What is the InChIKey of 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene?
The InChIKey is VWVDBHPRGLICOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20/c1-2-16(12-17-8-4-3-5-9-17)13-18-14-19-10-6-7-11-20(19)15-18/h2,4,6-11,13-14H,1,3,5,12,15H2.
What are the key properties of 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene?
2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene has a molecular weight of 260.38 g/mol, XLogP of 5.41, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(cyclohexa-1,5-dien-1-ylmethyl)buta-1,3-dienyl]-1H-indene is sourced from PubChem (CID 123364554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).