C21H25BrN4S — CID 123364882
1-[(6-bromo-5,9-dimethyl-3,4,4a,5,6,9a-hexahydro-2H-carbazol-1-ylidene)amino]-3-phenylthiourea (PubChem CID 123364882) has the molecular formula C21H25BrN4S and a molecular weight of 445.43 g/mol. Its IUPAC name is 1-[(6-bromo-5,9-dimethyl-3,4,4a,5,6,9a-hexahydro-2H-carbazol-1-ylidene)amino]-3-phenylthiourea.
| Compound Name | 1-[(6-bromo-5,9-dimethyl-3,4,4a,5,6,9a-hexahydro-2H-carbazol-1-ylidene)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 123364882 |
| Molecular Formula | C21H25BrN4S |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-[(6-bromo-5,9-dimethyl-3,4,4a,5,6,9a-hexahydro-2H-carbazol-1-ylidene)amino]-3-phenylthiourea |
| SMILES | CC1C2=C(C=CC1Br)N(C)C1C(=NNC(=S)Nc3ccccc3)CCCC21 |
| InChI | InChI=1S/C21H25BrN4S/c1-13-16(22)11-12-18-19(13)15-9-6-10-17(20(15)26(18)2)24-25-21(27)23-14-7-4-3-5-8-14/h3-5,7-8,11-13,15-16,20H,6,9-10H2,1-2H3,(H2,23,25,27) |
| InChIKey | RAIPUUJPJXAOHL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|