About N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide
N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide (PubChem CID 123365498) has the molecular formula C15H19FN2
and a molecular weight of 246.33 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide |
| PubChem CID | 123365498 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide |
| SMILES | C=C(C)C/C=C/N=C(\C)N(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2/c1-12(2)6-5-11-17-13(3)18(4)15-9-7-14(16)8-10-15/h5,7-11H,1,6H2,2-4H3/b11-5+,17-13+ |
| InChIKey | LEDMWYDOOYFHOB-IXAZELJASA-N |
| XLogP | 4.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide?
The IUPAC name of N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide (CID 123365498) is N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide.
What is the SMILES notation for N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide?
The canonical SMILES for N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide is C=C(C)C/C=C/N=C(\C)N(C)c1ccc(F)cc1.
What is the InChIKey of N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide?
The InChIKey is LEDMWYDOOYFHOB-IXAZELJASA-N. The full InChI is InChI=1S/C15H19FN2/c1-12(2)6-5-11-17-13(3)18(4)15-9-7-14(16)8-10-15/h5,7-11H,1,6H2,2-4H3/b11-5+,17-13+.
What are the key properties of N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide?
N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide has a molecular weight of 246.33 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-N-methyl-N'-[(1E)-4-methylpenta-1,4-dienyl]ethanimidamide is sourced from PubChem (CID 123365498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).